C17H29N5O5 — CID 142770505
tert-butyl N-[5-(methoxymethyl)-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate (PubChem CID 142770505) has the molecular formula C17H29N5O5 and a molecular weight of 383.45 g/mol. Its IUPAC name is tert-butyl N-[5-(methoxymethyl)-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate.
| Compound Name | tert-butyl N-[5-(methoxymethyl)-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate |
|---|---|
| PubChem CID | 142770505 |
| Molecular Formula | C17H29N5O5 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | tert-butyl N-[5-(methoxymethyl)-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate |
| SMILES | COCC1CCN(c2c([N+](=O)[O-])cnn2C)CCC1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29N5O5/c1-17(2,3)27-16(23)19-13-7-9-21(8-6-12(13)11-26-5)15-14(22(24)25)10-18-20(15)4/h10,12-13H,6-9,11H2,1-5H3,(H,19,23) |
| InChIKey | HQPWBZLLFFCRQN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|