C18H29N5O5 — CID 89484198
tert-butyl N-[(8R,9S)-8-methoxy-5-(1-methyl-4-nitropyrazol-5-yl)-5-azaspiro[2.6]nonan-9-yl]carbamate (PubChem CID 89484198) has the molecular formula C18H29N5O5 and a molecular weight of 395.46 g/mol. Its IUPAC name is tert-butyl N-[(8R,9S)-8-methoxy-5-(1-methyl-4-nitropyrazol-5-yl)-5-azaspiro[2.6]nonan-9-yl]carbamate.
| Compound Name | tert-butyl N-[(8R,9S)-8-methoxy-5-(1-methyl-4-nitropyrazol-5-yl)-5-azaspiro[2.6]nonan-9-yl]carbamate |
|---|---|
| PubChem CID | 89484198 |
| Molecular Formula | C18H29N5O5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | tert-butyl N-[(8R,9S)-8-methoxy-5-(1-methyl-4-nitropyrazol-5-yl)-5-azaspiro[2.6]nonan-9-yl]carbamate |
| SMILES | CO[C@@H]1CCN(c2c([N+](=O)[O-])cnn2C)CC2(CC2)[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29N5O5/c1-17(2,3)28-16(24)20-14-13(27-5)6-9-22(11-18(14)7-8-18)15-12(23(25)26)10-19-21(15)4/h10,13-14H,6-9,11H2,1-5H3,(H,20,24)/t13-,14-/m1/s1 |
| InChIKey | CTDDBDQWULQRON-ZIAGYGMSSA-N |
| XLogP | 2.23 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|