C13H19FN4O5 — CID 89456986
[5-fluoro-2-methoxy-5-(1-methyl-4-nitropyrazol-5-yl)cycloheptyl]carbamic acid (PubChem CID 89456986) has the molecular formula C13H19FN4O5 and a molecular weight of 330.32 g/mol. Its IUPAC name is [5-fluoro-2-methoxy-5-(1-methyl-4-nitropyrazol-5-yl)cycloheptyl]carbamic acid.
| Compound Name | [5-fluoro-2-methoxy-5-(1-methyl-4-nitropyrazol-5-yl)cycloheptyl]carbamic acid |
|---|---|
| PubChem CID | 89456986 |
| Molecular Formula | C13H19FN4O5 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [5-fluoro-2-methoxy-5-(1-methyl-4-nitropyrazol-5-yl)cycloheptyl]carbamic acid |
| SMILES | COC1CCC(F)(c2c([N+](=O)[O-])cnn2C)CCC1NC(=O)O |
| InChI | InChI=1S/C13H19FN4O5/c1-17-11(9(7-15-17)18(21)22)13(14)5-3-8(16-12(19)20)10(23-2)4-6-13/h7-8,10,16H,3-6H2,1-2H3,(H,19,20) |
| InChIKey | FCYUJZBGBYPKPX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|