C16H27FN6O4 — CID 152631457
tert-butyl N-[[6-fluoro-6-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]amino]carbamate (PubChem CID 152631457) has the molecular formula C16H27FN6O4 and a molecular weight of 386.43 g/mol. Its IUPAC name is tert-butyl N-[[6-fluoro-6-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[6-fluoro-6-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]amino]carbamate |
|---|---|
| PubChem CID | 152631457 |
| Molecular Formula | C16H27FN6O4 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | tert-butyl N-[[6-fluoro-6-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]amino]carbamate |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCC(NNC(=O)OC(C)(C)C)CC(C)(F)C1 |
| InChI | InChI=1S/C16H27FN6O4/c1-15(2,3)27-14(24)20-19-11-6-7-22(10-16(4,17)8-11)13-12(23(25)26)9-18-21(13)5/h9,11,19H,6-8,10H2,1-5H3,(H,20,24) |
| InChIKey | ZDPUALKEWCPFAY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|