C11H16N6O5 — CID 175286055
[[1-(1-methyl-4-nitropyrazol-5-yl)-6-oxoazepan-4-yl]amino]carbamic acid (PubChem CID 175286055) has the molecular formula C11H16N6O5 and a molecular weight of 312.29 g/mol. Its IUPAC name is [[1-(1-methyl-4-nitropyrazol-5-yl)-6-oxoazepan-4-yl]amino]carbamic acid.
| Compound Name | [[1-(1-methyl-4-nitropyrazol-5-yl)-6-oxoazepan-4-yl]amino]carbamic acid |
|---|---|
| PubChem CID | 175286055 |
| Molecular Formula | C11H16N6O5 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [[1-(1-methyl-4-nitropyrazol-5-yl)-6-oxoazepan-4-yl]amino]carbamic acid |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCC(NNC(=O)O)CC(=O)C1 |
| InChI | InChI=1S/C11H16N6O5/c1-15-10(9(5-12-15)17(21)22)16-3-2-7(4-8(18)6-16)13-14-11(19)20/h5,7,13-14H,2-4,6H2,1H3,(H,19,20) |
| InChIKey | RFKOQXPKYUFMEO-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|