About [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid
[(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid (PubChem CID 89456612) has the molecular formula C11H17N5O5
and a molecular weight of 299.29 g/mol. Its IUPAC name is [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid.
Molecular Properties
| Compound Name | [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid |
| PubChem CID | 89456612 |
| Molecular Formula | C11H17N5O5 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CC[C@H](NC(=O)O)[C@@H](O)CC1 |
| InChI | InChI=1S/C11H17N5O5/c1-14-10(8(6-12-14)16(20)21)15-4-2-7(13-11(18)19)9(17)3-5-15/h6-7,9,13,17H,2-5H2,1H3,(H,18,19)/t7-,9-/m0/s1 |
| InChIKey | XJPFHSUWBFUPAA-CBAPKCEASA-N |
| XLogP | -0.07 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid?
The IUPAC name of [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid (CID 89456612) is [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid.
What is the SMILES notation for [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid?
The canonical SMILES for [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid is Cn1ncc([N+](=O)[O-])c1N1CC[C@H](NC(=O)O)[C@@H](O)CC1.
What is the InChIKey of [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid?
The InChIKey is XJPFHSUWBFUPAA-CBAPKCEASA-N. The full InChI is InChI=1S/C11H17N5O5/c1-14-10(8(6-12-14)16(20)21)15-4-2-7(13-11(18)19)9(17)3-5-15/h6-7,9,13,17H,2-5H2,1H3,(H,18,19)/t7-,9-/m0/s1.
What are the key properties of [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid?
[(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid has a molecular weight of 299.29 g/mol, XLogP of -0.07, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S,5S)-5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid is sourced from PubChem (CID 89456612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).