C17H28N4O6 — CID 123886171
tert-butyl N-[3-methoxy-2-methyl-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate (PubChem CID 123886171) has the molecular formula C17H28N4O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is tert-butyl N-[3-methoxy-2-methyl-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate.
| Compound Name | tert-butyl N-[3-methoxy-2-methyl-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate |
|---|---|
| PubChem CID | 123886171 |
| Molecular Formula | C17H28N4O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | tert-butyl N-[3-methoxy-2-methyl-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate |
| SMILES | COC1C(NC(=O)OC(C)(C)C)CCC(c2c([N+](=O)[O-])cnn2C)OC1C |
| InChI | InChI=1S/C17H28N4O6/c1-10-15(25-6)11(19-16(22)27-17(2,3)4)7-8-13(26-10)14-12(21(23)24)9-18-20(14)5/h9-11,13,15H,7-8H2,1-6H3,(H,19,22) |
| InChIKey | OWIWYMBZJVLRTI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|