C12H16BrN3O5 — CID 125493182
[(3R,4R,7R)-3-bromo-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl] acetate (PubChem CID 125493182) has the molecular formula C12H16BrN3O5 and a molecular weight of 362.18 g/mol. Its IUPAC name is [(3R,4R,7R)-3-bromo-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl] acetate.
| Compound Name | [(3R,4R,7R)-3-bromo-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl] acetate |
|---|---|
| PubChem CID | 125493182 |
| Molecular Formula | C12H16BrN3O5 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | [(3R,4R,7R)-3-bromo-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@H](c2c([N+](=O)[O-])cnn2C)OC[C@H]1Br |
| InChI | InChI=1S/C12H16BrN3O5/c1-7(17)21-10-3-4-11(20-6-8(10)13)12-9(16(18)19)5-14-15(12)2/h5,8,10-11H,3-4,6H2,1-2H3/t8-,10-,11-/m1/s1 |
| InChIKey | XGEVFCZRCHSNNX-FBIMIBRVSA-N |
| XLogP | 1.88 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|