C11H16N6O4 — CID 90072465
5-[5-azido-6-(trideuteriomethoxy)oxepan-2-yl]-1-methyl-4-nitropyrazole (PubChem CID 90072465) has the molecular formula C11H16N6O4 and a molecular weight of 299.31 g/mol. Its IUPAC name is 5-[5-azido-6-(trideuteriomethoxy)oxepan-2-yl]-1-methyl-4-nitropyrazole.
| Compound Name | 5-[5-azido-6-(trideuteriomethoxy)oxepan-2-yl]-1-methyl-4-nitropyrazole |
|---|---|
| PubChem CID | 90072465 |
| Molecular Formula | C11H16N6O4 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 5-[5-azido-6-(trideuteriomethoxy)oxepan-2-yl]-1-methyl-4-nitropyrazole |
| SMILES | [2H]C([2H])([2H])OC1COC(c2c([N+](=O)[O-])cnn2C)CCC1N=[N+]=[N-] |
| InChI | InChI=1S/C11H16N6O4/c1-16-11(8(5-13-16)17(18)19)9-4-3-7(14-15-12)10(20-2)6-21-9/h5,7,9-10H,3-4,6H2,1-2H3/i2D3 |
| InChIKey | IFXCLZZXTHGWKT-BMSJAHLVSA-N |
| XLogP | 1.87 |
| TPSA | 128.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|