C11H15N6O4+ — CID 158557854
imino-[(2S,4R,7S)-2-methyl-7-(1-methyl-4-nitropyrazol-5-yl)-3-oxooxepan-4-yl]iminoazanium (PubChem CID 158557854) has the molecular formula C11H15N6O4+ and a molecular weight of 295.28 g/mol. Its IUPAC name is imino-[(2S,4R,7S)-2-methyl-7-(1-methyl-4-nitropyrazol-5-yl)-3-oxooxepan-4-yl]iminoazanium.
| Compound Name | imino-[(2S,4R,7S)-2-methyl-7-(1-methyl-4-nitropyrazol-5-yl)-3-oxooxepan-4-yl]iminoazanium |
|---|---|
| PubChem CID | 158557854 |
| Molecular Formula | C11H15N6O4+ |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | imino-[(2S,4R,7S)-2-methyl-7-(1-methyl-4-nitropyrazol-5-yl)-3-oxooxepan-4-yl]iminoazanium |
| SMILES | C[C@@H]1O[C@H](c2c([N+](=O)[O-])cnn2C)CC[C@@H](N=[N+]=N)C1=O |
| InChI | InChI=1S/C11H15N6O4/c1-6-11(18)7(14-15-12)3-4-9(21-6)10-8(17(19)20)5-13-16(10)2/h5-7,9,12H,3-4H2,1-2H3/q+1/t6-,7+,9-/m0/s1 |
| InChIKey | MTCOTTQPFAAUAV-OOZYFLPDSA-N |
| XLogP | 1.06 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|