C10H14N6O4 — CID 90085212
(4S,5S)-5-azido-2-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-ol (PubChem CID 90085212) has the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is (4S,5S)-5-azido-2-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-ol.
| Compound Name | (4S,5S)-5-azido-2-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-ol |
|---|---|
| PubChem CID | 90085212 |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (4S,5S)-5-azido-2-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-ol |
| SMILES | Cn1ncc([N+](=O)[O-])c1C1C[C@H](O)[C@@H](N=[N+]=[N-])CCO1 |
| InChI | InChI=1S/C10H14N6O4/c1-15-10(7(5-12-15)16(18)19)9-4-8(17)6(13-14-11)2-3-20-9/h5-6,8-9,17H,2-4H2,1H3/t6-,8-,9?/m0/s1 |
| InChIKey | ROMAOZATQIFCNL-ICIOHDDNSA-N |
| XLogP | 1.22 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|