C11H14N6O3 — CID 89458014
(1S,7R)-7-azido-4-(1-methyl-4-nitropyrazol-5-yl)cyclohept-3-en-1-ol (PubChem CID 89458014) has the molecular formula C11H14N6O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is (1S,7R)-7-azido-4-(1-methyl-4-nitropyrazol-5-yl)cyclohept-3-en-1-ol.
| Compound Name | (1S,7R)-7-azido-4-(1-methyl-4-nitropyrazol-5-yl)cyclohept-3-en-1-ol |
|---|---|
| PubChem CID | 89458014 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (1S,7R)-7-azido-4-(1-methyl-4-nitropyrazol-5-yl)cyclohept-3-en-1-ol |
| SMILES | Cn1ncc([N+](=O)[O-])c1C1=CC[C@H](O)[C@H](N=[N+]=[N-])CC1 |
| InChI | InChI=1S/C11H14N6O3/c1-16-11(9(6-13-16)17(19)20)7-2-4-8(14-15-12)10(18)5-3-7/h3,6,8,10,18H,2,4-5H2,1H3/t8-,10+/m1/s1 |
| InChIKey | ZMFUECKNXQGLRD-SCZZXKLOSA-N |
| XLogP | 1.94 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|