C15H23FN4O5 — CID 118270554
tert-butyl N-[(3S)-3-fluoro-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate (PubChem CID 118270554) has the molecular formula C15H23FN4O5 and a molecular weight of 358.37 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-fluoro-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-3-fluoro-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate |
|---|---|
| PubChem CID | 118270554 |
| Molecular Formula | C15H23FN4O5 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | tert-butyl N-[(3S)-3-fluoro-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate |
| SMILES | Cn1ncc([N+](=O)[O-])c1C1CCC(NC(=O)OC(C)(C)C)[C@H](F)CO1 |
| InChI | InChI=1S/C15H23FN4O5/c1-15(2,3)25-14(21)18-10-5-6-12(24-8-9(10)16)13-11(20(22)23)7-17-19(13)4/h7,9-10,12H,5-6,8H2,1-4H3,(H,18,21)/t9-,10?,12?/m1/s1 |
| InChIKey | BMHSXWRRGGOCRL-GRZMOONWSA-N |
| XLogP | 2.41 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|