C15H24N4O5 — CID 144595344
tert-butyl N-[7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate (PubChem CID 144595344) has the molecular formula C15H24N4O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is tert-butyl N-[7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate.
| Compound Name | tert-butyl N-[7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate |
|---|---|
| PubChem CID | 144595344 |
| Molecular Formula | C15H24N4O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | tert-butyl N-[7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-yl]carbamate |
| SMILES | Cn1ncc([N+](=O)[O-])c1C1CCC(NC(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C15H24N4O5/c1-15(2,3)24-14(20)17-10-5-6-12(23-8-7-10)13-11(19(21)22)9-16-18(13)4/h9-10,12H,5-8H2,1-4H3,(H,17,20) |
| InChIKey | SAUWXOJTDTUFBL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|