C10H14FN3O3 — CID 144923536
5-(6-fluorooxepan-2-yl)-1-methyl-4-nitropyrazole (PubChem CID 144923536) has the molecular formula C10H14FN3O3 and a molecular weight of 243.24 g/mol. Its IUPAC name is 5-(6-fluorooxepan-2-yl)-1-methyl-4-nitropyrazole.
| Compound Name | 5-(6-fluorooxepan-2-yl)-1-methyl-4-nitropyrazole |
|---|---|
| PubChem CID | 144923536 |
| Molecular Formula | C10H14FN3O3 |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 5-(6-fluorooxepan-2-yl)-1-methyl-4-nitropyrazole |
| SMILES | Cn1ncc([N+](=O)[O-])c1C1CCCC(F)CO1 |
| InChI | InChI=1S/C10H14FN3O3/c1-13-10(8(5-12-13)14(15)16)9-4-2-3-7(11)6-17-9/h5,7,9H,2-4,6H2,1H3 |
| InChIKey | HPXFLZHJJULJRW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|