C15H20F2N4O5 — CID 162596289
tert-butyl N-[(7S)-3,3-difluoro-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-ylidene]carbamate (PubChem CID 162596289) has the molecular formula C15H20F2N4O5 and a molecular weight of 374.34 g/mol. Its IUPAC name is tert-butyl N-[(7S)-3,3-difluoro-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-ylidene]carbamate.
| Compound Name | tert-butyl N-[(7S)-3,3-difluoro-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-ylidene]carbamate |
|---|---|
| PubChem CID | 162596289 |
| Molecular Formula | C15H20F2N4O5 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | tert-butyl N-[(7S)-3,3-difluoro-7-(1-methyl-4-nitropyrazol-5-yl)oxepan-4-ylidene]carbamate |
| SMILES | Cn1ncc([N+](=O)[O-])c1[C@@H]1CCC(=NC(=O)OC(C)(C)C)C(F)(F)CO1 |
| InChI | InChI=1S/C15H20F2N4O5/c1-14(2,3)26-13(22)19-11-6-5-10(25-8-15(11,16)17)12-9(21(23)24)7-18-20(12)4/h7,10H,5-6,8H2,1-4H3/t10-/m0/s1 |
| InChIKey | HOWMNOKUOZHFKA-JTQLQIEISA-N |
| XLogP | 3.19 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|