C12H16FN3O3 — CID 140575133
(3R,4R)-3-fluoro-1-(3-methoxy-4-nitrophenyl)piperidin-4-amine (PubChem CID 140575133) has the molecular formula C12H16FN3O3 and a molecular weight of 269.28 g/mol. Its IUPAC name is (3R,4R)-3-fluoro-1-(3-methoxy-4-nitrophenyl)piperidin-4-amine.
| Compound Name | (3R,4R)-3-fluoro-1-(3-methoxy-4-nitrophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 140575133 |
| Molecular Formula | C12H16FN3O3 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (3R,4R)-3-fluoro-1-(3-methoxy-4-nitrophenyl)piperidin-4-amine |
| SMILES | COc1cc(N2CC[C@@H](N)[C@H](F)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16FN3O3/c1-19-12-6-8(2-3-11(12)16(17)18)15-5-4-10(14)9(13)7-15/h2-3,6,9-10H,4-5,7,14H2,1H3/t9-,10-/m1/s1 |
| InChIKey | BIRAFUNOFCLCNN-NXEZZACHSA-N |
| XLogP | 1.48 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|