C11H12N2O3 — CID 175593834
1-(3-methoxy-4-nitrophenyl)-2,5-dihydropyrrole (PubChem CID 175593834) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-(3-methoxy-4-nitrophenyl)-2,5-dihydropyrrole.
| Compound Name | 1-(3-methoxy-4-nitrophenyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 175593834 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(3-methoxy-4-nitrophenyl)-2,5-dihydropyrrole |
| SMILES | COc1cc(N2CC=CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O3/c1-16-11-8-9(12-6-2-3-7-12)4-5-10(11)13(14)15/h2-5,8H,6-7H2,1H3 |
| InChIKey | NCFXGFABTLLYOB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|