C11H14N2O4 — CID 71301761
(3S)-1-(3-methoxy-4-nitrophenyl)pyrrolidin-3-ol (PubChem CID 71301761) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is (3S)-1-(3-methoxy-4-nitrophenyl)pyrrolidin-3-ol.
| Compound Name | (3S)-1-(3-methoxy-4-nitrophenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 71301761 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (3S)-1-(3-methoxy-4-nitrophenyl)pyrrolidin-3-ol |
| SMILES | COc1cc(N2CC[C@H](O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N2O4/c1-17-11-6-8(2-3-10(11)13(15)16)12-5-4-9(14)7-12/h2-3,6,9,14H,4-5,7H2,1H3/t9-/m0/s1 |
| InChIKey | IRPVQBHMMZEOMC-VIFPVBQESA-N |
| XLogP | 1.17 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|