C17H24N2O5 — CID 133444504
methyl 2-[1-(3-methoxy-4-nitrophenyl)piperidin-3-yl]-2-methylpropanoate (PubChem CID 133444504) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl 2-[1-(3-methoxy-4-nitrophenyl)piperidin-3-yl]-2-methylpropanoate.
| Compound Name | methyl 2-[1-(3-methoxy-4-nitrophenyl)piperidin-3-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 133444504 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | methyl 2-[1-(3-methoxy-4-nitrophenyl)piperidin-3-yl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)C1CCCN(c2ccc([N+](=O)[O-])c(OC)c2)C1 |
| InChI | InChI=1S/C17H24N2O5/c1-17(2,16(20)24-4)12-6-5-9-18(11-12)13-7-8-14(19(21)22)15(10-13)23-3/h7-8,10,12H,5-6,9,11H2,1-4H3 |
| InChIKey | DPXBGXLAXCMJII-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|