C17H24N2O4 — CID 133444494
methyl 2-methyl-2-[1-(2-methyl-6-nitrophenyl)piperidin-3-yl]propanoate (PubChem CID 133444494) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl 2-methyl-2-[1-(2-methyl-6-nitrophenyl)piperidin-3-yl]propanoate.
| Compound Name | methyl 2-methyl-2-[1-(2-methyl-6-nitrophenyl)piperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 133444494 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | methyl 2-methyl-2-[1-(2-methyl-6-nitrophenyl)piperidin-3-yl]propanoate |
| SMILES | COC(=O)C(C)(C)C1CCCN(c2c(C)cccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H24N2O4/c1-12-7-5-9-14(19(21)22)15(12)18-10-6-8-13(11-18)17(2,3)16(20)23-4/h5,7,9,13H,6,8,10-11H2,1-4H3 |
| InChIKey | VYOLFXXZXQANFJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|