C28H44N6O4 — CID 161181204
1-(4-amino-3-methoxyphenyl)-N,N-dimethylpiperidin-4-amine;1-(3-methoxy-4-nitrophenyl)-N,N-dimethylpiperidin-4-amine (PubChem CID 161181204) has the molecular formula C28H44N6O4 and a molecular weight of 528.70 g/mol. Its IUPAC name is 1-(4-amino-3-methoxyphenyl)-N,N-dimethylpiperidin-4-amine;1-(3-methoxy-4-nitrophenyl)-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-(4-amino-3-methoxyphenyl)-N,N-dimethylpiperidin-4-amine;1-(3-methoxy-4-nitrophenyl)-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 161181204 |
| Molecular Formula | C28H44N6O4 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.34 |
| IUPAC Name | 1-(4-amino-3-methoxyphenyl)-N,N-dimethylpiperidin-4-amine;1-(3-methoxy-4-nitrophenyl)-N,N-dimethylpiperidin-4-amine |
| SMILES | COc1cc(N2CCC(N(C)C)CC2)ccc1N.COc1cc(N2CCC(N(C)C)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O3.C14H23N3O/c1-15(2)11-6-8-16(9-7-11)12-4-5-13(17(18)19)14(10-12)20-3;1-16(2)11-6-8-17(9-7-11)12-4-5-13(15)14(10-12)18-3/h4-5,10-11H,6-9H2,1-3H3;4-5,10-11H,6-9,15H2,1-3H3 |
| InChIKey | USMAVTHAAVLDBY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|