C32H48N6O6 — CID 158570473
2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)aniline;4-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]morpholine (PubChem CID 158570473) has the molecular formula C32H48N6O6 and a molecular weight of 612.77 g/mol. Its IUPAC name is 2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)aniline;4-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]morpholine.
| Compound Name | 2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)aniline;4-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 158570473 |
| Molecular Formula | C32H48N6O6 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.36 |
| IUPAC Name | 2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)aniline;4-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]morpholine |
| SMILES | COc1cc(N2CCC(N3CCOCC3)CC2)ccc1N.COc1cc(N2CCC(N3CCOCC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N3O4.C16H25N3O2/c1-22-16-12-14(2-3-15(16)19(20)21)17-6-4-13(5-7-17)18-8-10-23-11-9-18;1-20-16-12-14(2-3-15(16)17)18-6-4-13(5-7-18)19-8-10-21-11-9-19/h2-3,12-13H,4-11H2,1H3;2-3,12-13H,4-11,17H2,1H3 |
| InChIKey | HSAARUYVAABJIY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|