C16H24N3O3+ — CID 142939386
[2-methoxy-5-(4-morpholin-4-ylpiperidin-1-yl)phenyl]-oxoazanium (PubChem CID 142939386) has the molecular formula C16H24N3O3+ and a molecular weight of 306.39 g/mol. Its IUPAC name is [2-methoxy-5-(4-morpholin-4-ylpiperidin-1-yl)phenyl]-oxoazanium.
| Compound Name | [2-methoxy-5-(4-morpholin-4-ylpiperidin-1-yl)phenyl]-oxoazanium |
|---|---|
| PubChem CID | 142939386 |
| Molecular Formula | C16H24N3O3+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [2-methoxy-5-(4-morpholin-4-ylpiperidin-1-yl)phenyl]-oxoazanium |
| SMILES | COc1ccc(N2CCC(N3CCOCC3)CC2)cc1[NH+]=O |
| InChI | InChI=1S/C16H23N3O3/c1-21-16-3-2-14(12-15(16)17-20)18-6-4-13(5-7-18)19-8-10-22-11-9-19/h2-3,12-13H,4-11H2,1H3/p+1 |
| InChIKey | QERATAGOGBFZBN-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|