C27H34N8O3 — CID 118352144
1-(3-aminophenyl)-3-[2-[2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]urea (PubChem CID 118352144) has the molecular formula C27H34N8O3 and a molecular weight of 518.62 g/mol. Its IUPAC name is 1-(3-aminophenyl)-3-[2-[2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]urea.
| Compound Name | 1-(3-aminophenyl)-3-[2-[2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 118352144 |
| Molecular Formula | C27H34N8O3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 1-(3-aminophenyl)-3-[2-[2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]urea |
| SMILES | COc1cc(N2CCC(N3CCOCC3)CC2)ccc1Nc1nccc(NC(=O)Nc2cccc(N)c2)n1 |
| InChI | InChI=1S/C27H34N8O3/c1-37-24-18-22(34-11-8-21(9-12-34)35-13-15-38-16-14-35)5-6-23(24)31-26-29-10-7-25(32-26)33-27(36)30-20-4-2-3-19(28)17-20/h2-7,10,17-18,21H,8-9,11-16,28H2,1H3,(H3,29,30,31,32,33,36) |
| InChIKey | KDDFMMHFUSJQKO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|