C24H26N6O5 — CID 87312824
N-cyclobutyl-3-methoxy-4-[[4-[(2-morpholin-4-yl-3,4-dioxocyclobuten-1-yl)amino]pyrimidin-2-yl]amino]benzamide (PubChem CID 87312824) has the molecular formula C24H26N6O5 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-cyclobutyl-3-methoxy-4-[[4-[(2-morpholin-4-yl-3,4-dioxocyclobuten-1-yl)amino]pyrimidin-2-yl]amino]benzamide.
| Compound Name | N-cyclobutyl-3-methoxy-4-[[4-[(2-morpholin-4-yl-3,4-dioxocyclobuten-1-yl)amino]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 87312824 |
| Molecular Formula | C24H26N6O5 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-cyclobutyl-3-methoxy-4-[[4-[(2-morpholin-4-yl-3,4-dioxocyclobuten-1-yl)amino]pyrimidin-2-yl]amino]benzamide |
| SMILES | COc1cc(C(=O)NC2CCC2)ccc1Nc1nccc(Nc2c(N3CCOCC3)c(=O)c2=O)n1 |
| InChI | InChI=1S/C24H26N6O5/c1-34-17-13-14(23(33)26-15-3-2-4-15)5-6-16(17)27-24-25-8-7-18(29-24)28-19-20(22(32)21(19)31)30-9-11-35-12-10-30/h5-8,13,15H,2-4,9-12H2,1H3,(H,26,33)(H2,25,27,28,29) |
| InChIKey | FKPSDMKYOWZMFL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|