C26H32N6O3 — CID 87312400
3-[[4-[[2-(tert-butylamino)-3,4-dioxocyclobuten-1-yl]amino]pyrimidin-2-yl]amino]-N-cycloheptylbenzamide (PubChem CID 87312400) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 3-[[4-[[2-(tert-butylamino)-3,4-dioxocyclobuten-1-yl]amino]pyrimidin-2-yl]amino]-N-cycloheptylbenzamide.
| Compound Name | 3-[[4-[[2-(tert-butylamino)-3,4-dioxocyclobuten-1-yl]amino]pyrimidin-2-yl]amino]-N-cycloheptylbenzamide |
|---|---|
| PubChem CID | 87312400 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 3-[[4-[[2-(tert-butylamino)-3,4-dioxocyclobuten-1-yl]amino]pyrimidin-2-yl]amino]-N-cycloheptylbenzamide |
| SMILES | CC(C)(C)Nc1c(Nc2ccnc(Nc3cccc(C(=O)NC4CCCCCC4)c3)n2)c(=O)c1=O |
| InChI | InChI=1S/C26H32N6O3/c1-26(2,3)32-21-20(22(33)23(21)34)30-19-13-14-27-25(31-19)29-18-12-8-9-16(15-18)24(35)28-17-10-6-4-5-7-11-17/h8-9,12-15,17,32H,4-7,10-11H2,1-3H3,(H,28,35)(H2,27,29,30,31) |
| InChIKey | XJAGOQZEBJXNHD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|