C21H21N7O2 — CID 87312264
3-(tert-butylamino)-4-[[2-[4-(1H-pyrazol-5-yl)anilino]pyrimidin-4-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 87312264) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 3-(tert-butylamino)-4-[[2-[4-(1H-pyrazol-5-yl)anilino]pyrimidin-4-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(tert-butylamino)-4-[[2-[4-(1H-pyrazol-5-yl)anilino]pyrimidin-4-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87312264 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 3-(tert-butylamino)-4-[[2-[4-(1H-pyrazol-5-yl)anilino]pyrimidin-4-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)(C)Nc1c(Nc2ccnc(Nc3ccc(-c4ccn[nH]4)cc3)n2)c(=O)c1=O |
| InChI | InChI=1S/C21H21N7O2/c1-21(2,3)27-17-16(18(29)19(17)30)25-15-9-10-22-20(26-15)24-13-6-4-12(5-7-13)14-8-11-23-28-14/h4-11,27H,1-3H3,(H,23,28)(H2,22,24,25,26) |
| InChIKey | URBKRMFCZOMKQZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|