C16H24N4O — CID 143939187
4-[[2-(tert-butylamino)pyrimidin-4-yl]amino]phenol;ethane (PubChem CID 143939187) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is 4-[[2-(tert-butylamino)pyrimidin-4-yl]amino]phenol;ethane.
| Compound Name | 4-[[2-(tert-butylamino)pyrimidin-4-yl]amino]phenol;ethane |
|---|---|
| PubChem CID | 143939187 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 4-[[2-(tert-butylamino)pyrimidin-4-yl]amino]phenol;ethane |
| SMILES | CC.CC(C)(C)Nc1nccc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C14H18N4O.C2H6/c1-14(2,3)18-13-15-9-8-12(17-13)16-10-4-6-11(19)7-5-10;1-2/h4-9,19H,1-3H3,(H2,15,16,17,18);1-2H3 |
| InChIKey | FCNBTWHDEGIRQA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|