C16H19FN4O — CID 143131648
acetylene;1-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]-2-methylpropan-2-ol (PubChem CID 143131648) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is acetylene;1-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]-2-methylpropan-2-ol.
| Compound Name | acetylene;1-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 143131648 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | acetylene;1-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]-2-methylpropan-2-ol |
| SMILES | C#C.CC(C)(O)CNc1nccc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H17FN4O.C2H2/c1-14(2,20)9-17-13-16-8-7-12(19-13)18-11-5-3-10(15)4-6-11;1-2/h3-8,20H,9H2,1-2H3,(H2,16,17,18,19);1-2H |
| InChIKey | WXENBUVIVBNXSJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|