C17H21FN4O5 — CID 69113379
(3S)-3-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]-2-methylbutan-2-ol;oxalic acid (PubChem CID 69113379) has the molecular formula C17H21FN4O5 and a molecular weight of 380.38 g/mol. Its IUPAC name is (3S)-3-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]-2-methylbutan-2-ol;oxalic acid.
| Compound Name | (3S)-3-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]-2-methylbutan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 69113379 |
| Molecular Formula | C17H21FN4O5 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (3S)-3-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]-2-methylbutan-2-ol;oxalic acid |
| SMILES | C[C@H](Nc1nccc(Nc2ccc(F)cc2)n1)C(C)(C)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H19FN4O.C2H2O4/c1-10(15(2,3)21)18-14-17-9-8-13(20-14)19-12-6-4-11(16)5-7-12;3-1(4)2(5)6/h4-10,21H,1-3H3,(H2,17,18,19,20);(H,3,4)(H,5,6)/t10-;/m0./s1 |
| InChIKey | FNVVTIPXZUYVLX-PPHPATTJSA-N |
| XLogP | 2.09 |
| TPSA | 144.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|