C20H28FN5O3 — CID 69113282
1-(4-fluorophenyl)-3-(4-hydroxybutyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]urea (PubChem CID 69113282) has the molecular formula C20H28FN5O3 and a molecular weight of 405.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(4-hydroxybutyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-(4-hydroxybutyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 69113282 |
| Molecular Formula | C20H28FN5O3 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(4-hydroxybutyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]urea |
| SMILES | CC(Nc1nccc(N(C(=O)NCCCCO)c2ccc(F)cc2)n1)C(C)(C)O |
| InChI | InChI=1S/C20H28FN5O3/c1-14(20(2,3)29)24-18-22-12-10-17(25-18)26(16-8-6-15(21)7-9-16)19(28)23-11-4-5-13-27/h6-10,12,14,27,29H,4-5,11,13H2,1-3H3,(H,23,28)(H,22,24,25) |
| InChIKey | JUNBFTMDTALFDF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|