C20H29N5O4 — CID 69113303
1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(2-methoxyethyl)-1-(4-methoxyphenyl)urea (PubChem CID 69113303) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(2-methoxyethyl)-1-(4-methoxyphenyl)urea.
| Compound Name | 1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(2-methoxyethyl)-1-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 69113303 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(2-methoxyethyl)-1-(4-methoxyphenyl)urea |
| SMILES | COCCNC(=O)N(c1ccc(OC)cc1)c1ccnc(NC(C)C(C)(C)O)n1 |
| InChI | InChI=1S/C20H29N5O4/c1-14(20(2,3)27)23-18-21-11-10-17(24-18)25(19(26)22-12-13-28-4)15-6-8-16(29-5)9-7-15/h6-11,14,27H,12-13H2,1-5H3,(H,22,26)(H,21,23,24) |
| InChIKey | KOOIYSICUAJAPR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|