C20H29N5O4 — CID 69118147
1-(4-ethoxyphenyl)-3-(2-methoxyethyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]urea (PubChem CID 69118147) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-(2-methoxyethyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-(2-methoxyethyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 69118147 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-(2-methoxyethyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]urea |
| SMILES | CCOc1ccc(N(C(=O)NCCOC)c2ccnc(NC(C)COC)n2)cc1 |
| InChI | InChI=1S/C20H29N5O4/c1-5-29-17-8-6-16(7-9-17)25(20(26)22-12-13-27-3)18-10-11-21-19(24-18)23-15(2)14-28-4/h6-11,15H,5,12-14H2,1-4H3,(H,22,26)(H,21,23,24) |
| InChIKey | VDPDTLKQZFPJGB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|