C23H24Cl3N5O3 — CID 69211152
1-(4-methoxyphenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-[(2,3,4-trichlorophenyl)methyl]urea (PubChem CID 69211152) has the molecular formula C23H24Cl3N5O3 and a molecular weight of 524.84 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-[(2,3,4-trichlorophenyl)methyl]urea.
| Compound Name | 1-(4-methoxyphenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-[(2,3,4-trichlorophenyl)methyl]urea |
|---|---|
| PubChem CID | 69211152 |
| Molecular Formula | C23H24Cl3N5O3 |
| Molecular Weight | 524.84 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 1-(4-methoxyphenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-[(2,3,4-trichlorophenyl)methyl]urea |
| SMILES | COCC(C)Nc1nccc(N(C(=O)NCc2ccc(Cl)c(Cl)c2Cl)c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C23H24Cl3N5O3/c1-14(13-33-2)29-22-27-11-10-19(30-22)31(16-5-7-17(34-3)8-6-16)23(32)28-12-15-4-9-18(24)21(26)20(15)25/h4-11,14H,12-13H2,1-3H3,(H,28,32)(H,27,29,30) |
| InChIKey | NTKKZFUASLJAFH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.84 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|