C18H24FN5O2 — CID 69113269
1-(4-fluorophenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-propylurea (PubChem CID 69113269) has the molecular formula C18H24FN5O2 and a molecular weight of 361.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-propylurea.
| Compound Name | 1-(4-fluorophenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-propylurea |
|---|---|
| PubChem CID | 69113269 |
| Molecular Formula | C18H24FN5O2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-(4-fluorophenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-propylurea |
| SMILES | CCCNC(=O)N(c1ccc(F)cc1)c1ccnc(NC(C)COC)n1 |
| InChI | InChI=1S/C18H24FN5O2/c1-4-10-21-18(25)24(15-7-5-14(19)6-8-15)16-9-11-20-17(23-16)22-13(2)12-26-3/h5-9,11,13H,4,10,12H2,1-3H3,(H,21,25)(H,20,22,23) |
| InChIKey | BOAGZMAUGPHLIN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |