C22H21Cl3FN5O2 — CID 69210956
1-(4-fluorophenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-[(2,3,4-trichlorophenyl)methyl]urea (PubChem CID 69210956) has the molecular formula C22H21Cl3FN5O2 and a molecular weight of 512.80 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-[(2,3,4-trichlorophenyl)methyl]urea.
| Compound Name | 1-(4-fluorophenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-[(2,3,4-trichlorophenyl)methyl]urea |
|---|---|
| PubChem CID | 69210956 |
| Molecular Formula | C22H21Cl3FN5O2 |
| Molecular Weight | 512.80 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 1-(4-fluorophenyl)-1-[2-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-3-[(2,3,4-trichlorophenyl)methyl]urea |
| SMILES | COCC(C)Nc1nccc(N(C(=O)NCc2ccc(Cl)c(Cl)c2Cl)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H21Cl3FN5O2/c1-13(12-33-2)29-21-27-10-9-18(30-21)31(16-6-4-15(26)5-7-16)22(32)28-11-14-3-8-17(23)20(25)19(14)24/h3-10,13H,11-12H2,1-2H3,(H,28,32)(H,27,29,30) |
| InChIKey | ODPNINKQTHAVNS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.80 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|