C22H22F3N5O3 — CID 69208279
1-(4-methoxyphenyl)-1-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-3-(2,3,5-trifluorophenyl)urea (PubChem CID 69208279) has the molecular formula C22H22F3N5O3 and a molecular weight of 461.44 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-1-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-3-(2,3,5-trifluorophenyl)urea.
| Compound Name | 1-(4-methoxyphenyl)-1-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-3-(2,3,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 69208279 |
| Molecular Formula | C22H22F3N5O3 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 1-(4-methoxyphenyl)-1-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-3-(2,3,5-trifluorophenyl)urea |
| SMILES | COC[C@H](C)Nc1nccc(N(C(=O)Nc2cc(F)cc(F)c2F)c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C22H22F3N5O3/c1-13(12-32-2)27-21-26-9-8-19(29-21)30(15-4-6-16(33-3)7-5-15)22(31)28-18-11-14(23)10-17(24)20(18)25/h4-11,13H,12H2,1-3H3,(H,28,31)(H,26,27,29)/t13-/m0/s1 |
| InChIKey | DDYGPFMJTIEUPN-ZDUSSCGKSA-N |
| XLogP | 4.72 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|