C21H22FN5O2 — CID 69210046
3-(3-fluorophenyl)-1-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-1-phenylurea (PubChem CID 69210046) has the molecular formula C21H22FN5O2 and a molecular weight of 395.44 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-1-phenylurea.
| Compound Name | 3-(3-fluorophenyl)-1-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-1-phenylurea |
|---|---|
| PubChem CID | 69210046 |
| Molecular Formula | C21H22FN5O2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-(3-fluorophenyl)-1-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-1-phenylurea |
| SMILES | COC[C@H](C)Nc1nccc(N(C(=O)Nc2cccc(F)c2)c2ccccc2)n1 |
| InChI | InChI=1S/C21H22FN5O2/c1-15(14-29-2)24-20-23-12-11-19(26-20)27(18-9-4-3-5-10-18)21(28)25-17-8-6-7-16(22)13-17/h3-13,15H,14H2,1-2H3,(H,25,28)(H,23,24,26)/t15-/m0/s1 |
| InChIKey | YAMGBUJLKUGCBU-HNNXBMFYSA-N |
| XLogP | 4.43 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |