C25H22FN5O — CID 69211309
1-(4-fluorophenyl)-3-phenyl-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea (PubChem CID 69211309) has the molecular formula C25H22FN5O and a molecular weight of 427.48 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-phenyl-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-phenyl-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 69211309 |
| Molecular Formula | C25H22FN5O |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-(4-fluorophenyl)-3-phenyl-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea |
| SMILES | CC(Nc1nccc(N(C(=O)Nc2ccccc2)c2ccc(F)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C25H22FN5O/c1-18(19-8-4-2-5-9-19)28-24-27-17-16-23(30-24)31(22-14-12-20(26)13-15-22)25(32)29-21-10-6-3-7-11-21/h2-18H,1H3,(H,29,32)(H,27,28,30) |
| InChIKey | WMRYVSITPHEFDA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |