C27H28N6O — CID 69208104
1-[4-(dimethylamino)phenyl]-3-phenyl-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea (PubChem CID 69208104) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-phenyl-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-phenyl-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 69208104 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-phenyl-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea |
| SMILES | CC(Nc1nccc(N(C(=O)Nc2ccccc2)c2ccc(N(C)C)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C27H28N6O/c1-20(21-10-6-4-7-11-21)29-26-28-19-18-25(31-26)33(24-16-14-23(15-17-24)32(2)3)27(34)30-22-12-8-5-9-13-22/h4-20H,1-3H3,(H,30,34)(H,28,29,31) |
| InChIKey | QIPFOMOMXCSYLI-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|