C23H27N5O2 — CID 69206748
1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(3-methylphenyl)-1-phenylurea (PubChem CID 69206748) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(3-methylphenyl)-1-phenylurea.
| Compound Name | 1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(3-methylphenyl)-1-phenylurea |
|---|---|
| PubChem CID | 69206748 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(3-methylphenyl)-1-phenylurea |
| SMILES | Cc1cccc(NC(=O)N(c2ccccc2)c2ccnc(NC(C)C(C)(C)O)n2)c1 |
| InChI | InChI=1S/C23H27N5O2/c1-16-9-8-10-18(15-16)26-22(29)28(19-11-6-5-7-12-19)20-13-14-24-21(27-20)25-17(2)23(3,4)30/h5-15,17,30H,1-4H3,(H,26,29)(H,24,25,27) |
| InChIKey | CQABNXJLAJPZAO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |