C22H22Cl3N5O2 — CID 69211218
1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-1-phenyl-3-(2,4,5-trichlorophenyl)urea (PubChem CID 69211218) has the molecular formula C22H22Cl3N5O2 and a molecular weight of 494.81 g/mol. Its IUPAC name is 1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-1-phenyl-3-(2,4,5-trichlorophenyl)urea.
| Compound Name | 1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-1-phenyl-3-(2,4,5-trichlorophenyl)urea |
|---|---|
| PubChem CID | 69211218 |
| Molecular Formula | C22H22Cl3N5O2 |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-1-phenyl-3-(2,4,5-trichlorophenyl)urea |
| SMILES | CC(Nc1nccc(N(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)c2ccccc2)n1)C(C)(C)O |
| InChI | InChI=1S/C22H22Cl3N5O2/c1-13(22(2,3)32)27-20-26-10-9-19(29-20)30(14-7-5-4-6-8-14)21(31)28-18-12-16(24)15(23)11-17(18)25/h4-13,32H,1-3H3,(H,28,31)(H,26,27,29) |
| InChIKey | KCEFHQPCHUTJHQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|