C22H21F4N5O2 — CID 69208185
1-(4-fluorophenyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 69208185) has the molecular formula C22H21F4N5O2 and a molecular weight of 463.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-(4-fluorophenyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 69208185 |
| Molecular Formula | C22H21F4N5O2 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 1-(4-fluorophenyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | CC(Nc1nccc(N(C(=O)Nc2cc(F)c(F)cc2F)c2ccc(F)cc2)n1)C(C)(C)O |
| InChI | InChI=1S/C22H21F4N5O2/c1-12(22(2,3)33)28-20-27-9-8-19(30-20)31(14-6-4-13(23)5-7-14)21(32)29-18-11-16(25)15(24)10-17(18)26/h4-12,33H,1-3H3,(H,29,32)(H,27,28,30) |
| InChIKey | QJBDAVPELKDDLS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|