C25H21F2N5O — CID 69212332
1-(2-fluorophenyl)-3-(4-fluorophenyl)-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea (PubChem CID 69212332) has the molecular formula C25H21F2N5O and a molecular weight of 445.47 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-(4-fluorophenyl)-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-(4-fluorophenyl)-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 69212332 |
| Molecular Formula | C25H21F2N5O |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-(2-fluorophenyl)-3-(4-fluorophenyl)-1-[2-(1-phenylethylamino)pyrimidin-4-yl]urea |
| SMILES | CC(Nc1nccc(N(C(=O)Nc2ccc(F)cc2)c2ccccc2F)n1)c1ccccc1 |
| InChI | InChI=1S/C25H21F2N5O/c1-17(18-7-3-2-4-8-18)29-24-28-16-15-23(31-24)32(22-10-6-5-9-21(22)27)25(33)30-20-13-11-19(26)12-14-20/h2-17H,1H3,(H,30,33)(H,28,29,31) |
| InChIKey | VXCABGGMLHQNKZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |