C22H33N5O4 — CID 69113250
1-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]urea (PubChem CID 69113250) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 69113250 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-1-[2-[(3-hydroxy-3-methylbutan-2-yl)amino]pyrimidin-4-yl]urea |
| SMILES | CCOc1ccc(N(C(=O)NCCCCO)c2ccnc(NC(C)C(C)(C)O)n2)cc1 |
| InChI | InChI=1S/C22H33N5O4/c1-5-31-18-10-8-17(9-11-18)27(21(29)24-13-6-7-15-28)19-12-14-23-20(26-19)25-16(2)22(3,4)30/h8-12,14,16,28,30H,5-7,13,15H2,1-4H3,(H,24,29)(H,23,25,26) |
| InChIKey | AMPVISCQNPASGX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|