C21H31N5O4 — CID 69113679
3-(4-hydroxybutyl)-1-[2-[[(2S)-3-hydroxy-3-methylbutan-2-yl]amino]pyrimidin-4-yl]-1-(4-methoxyphenyl)urea (PubChem CID 69113679) has the molecular formula C21H31N5O4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-(4-hydroxybutyl)-1-[2-[[(2S)-3-hydroxy-3-methylbutan-2-yl]amino]pyrimidin-4-yl]-1-(4-methoxyphenyl)urea.
| Compound Name | 3-(4-hydroxybutyl)-1-[2-[[(2S)-3-hydroxy-3-methylbutan-2-yl]amino]pyrimidin-4-yl]-1-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 69113679 |
| Molecular Formula | C21H31N5O4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 3-(4-hydroxybutyl)-1-[2-[[(2S)-3-hydroxy-3-methylbutan-2-yl]amino]pyrimidin-4-yl]-1-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(N(C(=O)NCCCCO)c2ccnc(N[C@@H](C)C(C)(C)O)n2)cc1 |
| InChI | InChI=1S/C21H31N5O4/c1-15(21(2,3)29)24-19-22-13-11-18(25-19)26(20(28)23-12-5-6-14-27)16-7-9-17(30-4)10-8-16/h7-11,13,15,27,29H,5-6,12,14H2,1-4H3,(H,23,28)(H,22,24,25)/t15-/m0/s1 |
| InChIKey | RFLGHEDNHJMUOE-HNNXBMFYSA-N |
| XLogP | 2.68 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|