C29H33N7O2 — CID 87312367
3-[[2-[4-(4-benzylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-4-(tert-butylamino)cyclobut-3-ene-1,2-dione (PubChem CID 87312367) has the molecular formula C29H33N7O2 and a molecular weight of 511.63 g/mol. Its IUPAC name is 3-[[2-[4-(4-benzylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-4-(tert-butylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[2-[4-(4-benzylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-4-(tert-butylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87312367 |
| Molecular Formula | C29H33N7O2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 3-[[2-[4-(4-benzylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-4-(tert-butylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)(C)Nc1c(Nc2ccnc(Nc3ccc(N4CCN(Cc5ccccc5)CC4)cc3)n2)c(=O)c1=O |
| InChI | InChI=1S/C29H33N7O2/c1-29(2,3)34-25-24(26(37)27(25)38)32-23-13-14-30-28(33-23)31-21-9-11-22(12-10-21)36-17-15-35(16-18-36)19-20-7-5-4-6-8-20/h4-14,34H,15-19H2,1-3H3,(H2,30,31,32,33) |
| InChIKey | HRZNXBUKEDCEQM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|