C25H26N6S — CID 11487559
N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-(2-methyl-1,3-thiazol-4-yl)pyrimidin-2-amine (PubChem CID 11487559) has the molecular formula C25H26N6S and a molecular weight of 442.59 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-(2-methyl-1,3-thiazol-4-yl)pyrimidin-2-amine.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-(2-methyl-1,3-thiazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 11487559 |
| Molecular Formula | C25H26N6S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-(2-methyl-1,3-thiazol-4-yl)pyrimidin-2-amine |
| SMILES | Cc1nc(-c2ccnc(Nc3ccc(N4CCN(Cc5ccccc5)CC4)cc3)n2)cs1 |
| InChI | InChI=1S/C25H26N6S/c1-19-27-24(18-32-19)23-11-12-26-25(29-23)28-21-7-9-22(10-8-21)31-15-13-30(14-16-31)17-20-5-3-2-4-6-20/h2-12,18H,13-17H2,1H3,(H,26,28,29) |
| InChIKey | FXGMGYTXVKQVTL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|