C21H21F2N5 — CID 112896317
4-(4-benzylpiperazin-1-yl)-N-(2,6-difluorophenyl)pyrimidin-2-amine (PubChem CID 112896317) has the molecular formula C21H21F2N5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-N-(2,6-difluorophenyl)pyrimidin-2-amine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-N-(2,6-difluorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112896317 |
| Molecular Formula | C21H21F2N5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-N-(2,6-difluorophenyl)pyrimidin-2-amine |
| SMILES | Fc1cccc(F)c1Nc1nccc(N2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C21H21F2N5/c22-17-7-4-8-18(23)20(17)26-21-24-10-9-19(25-21)28-13-11-27(12-14-28)15-16-5-2-1-3-6-16/h1-10H,11-15H2,(H,24,25,26) |
| InChIKey | OWAJOMIAUAGBQP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |